C10H8N4O2 — CID 137303794
8-methoxy-3,5-dihydrotriazino[5,4-b]indol-4-one (PubChem CID 137303794) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is 8-methoxy-3,5-dihydrotriazino[5,4-b]indol-4-one.
| Compound Name | 8-methoxy-3,5-dihydrotriazino[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 137303794 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 8-methoxy-3,5-dihydrotriazino[5,4-b]indol-4-one |
| SMILES | COc1ccc2[nH]c3c(=O)[nH]nnc3c2c1 |
| InChI | InChI=1S/C10H8N4O2/c1-16-5-2-3-7-6(4-5)8-9(11-7)10(15)13-14-12-8/h2-4,11H,1H3,(H,12,13,15) |
| InChIKey | RSGUFLLVORFJRJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |