C13H8N4O2S — CID 135797555
6-methoxy-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12-heptaen-15-one (PubChem CID 135797555) has the molecular formula C13H8N4O2S and a molecular weight of 284.30 g/mol. Its IUPAC name is 6-methoxy-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12-heptaen-15-one.
| Compound Name | 6-methoxy-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12-heptaen-15-one |
|---|---|
| PubChem CID | 135797555 |
| Molecular Formula | C13H8N4O2S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 6-methoxy-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12-heptaen-15-one |
| SMILES | COc1ccc2nc3sc4c(=O)[nH]nnc4c3cc2c1 |
| InChI | InChI=1S/C13H8N4O2S/c1-19-7-2-3-9-6(4-7)5-8-10-11(20-13(8)14-9)12(18)16-17-15-10/h2-5H,1H3,(H,15,16,18) |
| InChIKey | NVRXITZUNAGXEA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |