C15H14N2O3S — CID 865502
methyl 3-amino-6-ethoxythieno[2,3-b]quinoline-2-carboxylate (PubChem CID 865502) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is methyl 3-amino-6-ethoxythieno[2,3-b]quinoline-2-carboxylate.
| Compound Name | methyl 3-amino-6-ethoxythieno[2,3-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 865502 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | methyl 3-amino-6-ethoxythieno[2,3-b]quinoline-2-carboxylate |
| SMILES | CCOc1ccc2nc3sc(C(=O)OC)c(N)c3cc2c1 |
| InChI | InChI=1S/C15H14N2O3S/c1-3-20-9-4-5-11-8(6-9)7-10-12(16)13(15(18)19-2)21-14(10)17-11/h4-7H,3,16H2,1-2H3 |
| InChIKey | PNJMJHWPPGFAJI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |