C18H21N3O2S — CID 3207407
3-amino-N-tert-butyl-6-ethoxythieno[2,3-b]quinoline-2-carboxamide (PubChem CID 3207407) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-amino-N-tert-butyl-6-ethoxythieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-N-tert-butyl-6-ethoxythieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 3207407 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-amino-N-tert-butyl-6-ethoxythieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CCOc1ccc2nc3sc(C(=O)NC(C)(C)C)c(N)c3cc2c1 |
| InChI | InChI=1S/C18H21N3O2S/c1-5-23-11-6-7-13-10(8-11)9-12-14(19)15(24-17(12)20-13)16(22)21-18(2,3)4/h6-9H,5,19H2,1-4H3,(H,21,22) |
| InChIKey | NDTYWBLTIJVNAE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |