C13H9FN2O2S — CID 155568119
methyl 3-amino-6-fluorothieno[2,3-b]quinoline-2-carboxylate (PubChem CID 155568119) has the molecular formula C13H9FN2O2S and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 3-amino-6-fluorothieno[2,3-b]quinoline-2-carboxylate.
| Compound Name | methyl 3-amino-6-fluorothieno[2,3-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 155568119 |
| Molecular Formula | C13H9FN2O2S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | methyl 3-amino-6-fluorothieno[2,3-b]quinoline-2-carboxylate |
| SMILES | COC(=O)c1sc2nc3ccc(F)cc3cc2c1N |
| InChI | InChI=1S/C13H9FN2O2S/c1-18-13(17)11-10(15)8-5-6-4-7(14)2-3-9(6)16-12(8)19-11/h2-5H,15H2,1H3 |
| InChIKey | GFFAQKFGWNYDCS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |