C11H9FN2O2 — CID 84623443
methyl 2-amino-6-fluoroquinoline-4-carboxylate (PubChem CID 84623443) has the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. Its IUPAC name is methyl 2-amino-6-fluoroquinoline-4-carboxylate.
| Compound Name | methyl 2-amino-6-fluoroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 84623443 |
| Molecular Formula | C11H9FN2O2 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | methyl 2-amino-6-fluoroquinoline-4-carboxylate |
| SMILES | COC(=O)c1cc(N)nc2ccc(F)cc12 |
| InChI | InChI=1S/C11H9FN2O2/c1-16-11(15)8-5-10(13)14-9-3-2-6(12)4-7(8)9/h2-5H,1H3,(H2,13,14) |
| InChIKey | VQBNIPCFMIYHIB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |