About 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid
6-fluorothieno[2,3-b]quinoline-2-carboxylic acid (PubChem CID 44754716) has the molecular formula C12H6FNO2S
and a molecular weight of 247.25 g/mol. Its IUPAC name is 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid |
| PubChem CID | 44754716 |
| Molecular Formula | C12H6FNO2S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc3cc(F)ccc3nc2s1 |
| InChI | InChI=1S/C12H6FNO2S/c13-8-1-2-9-6(4-8)3-7-5-10(12(15)16)17-11(7)14-9/h1-5H,(H,15,16) |
| InChIKey | YKSXBLZXUWQCOU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid?
The IUPAC name of 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid (CID 44754716) is 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid.
What is the SMILES notation for 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid?
The canonical SMILES for 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid is O=C(O)c1cc2cc3cc(F)ccc3nc2s1.
What is the InChIKey of 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid?
The InChIKey is YKSXBLZXUWQCOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6FNO2S/c13-8-1-2-9-6(4-8)3-7-5-10(12(15)16)17-11(7)14-9/h1-5H,(H,15,16).
What are the key properties of 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid?
6-fluorothieno[2,3-b]quinoline-2-carboxylic acid has a molecular weight of 247.25 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorothieno[2,3-b]quinoline-2-carboxylic acid is sourced from PubChem (CID 44754716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).