C20H17N3O2S — CID 1156787
3-amino-6-ethoxy-N-phenylthieno[2,3-b]quinoline-2-carboxamide (PubChem CID 1156787) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-amino-6-ethoxy-N-phenylthieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-6-ethoxy-N-phenylthieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 1156787 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-amino-6-ethoxy-N-phenylthieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CCOc1ccc2nc3sc(C(=O)Nc4ccccc4)c(N)c3cc2c1 |
| InChI | InChI=1S/C20H17N3O2S/c1-2-25-14-8-9-16-12(10-14)11-15-17(21)18(26-20(15)23-16)19(24)22-13-6-4-3-5-7-13/h3-11H,2,21H2,1H3,(H,22,24) |
| InChIKey | SEWCEMQHMZTTEW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |