C12H9N5O2S — CID 5305197
13-amino-4-methoxy-14-thia-8,11,12,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,12,15-hexaen-10-one (PubChem CID 5305197) has the molecular formula C12H9N5O2S and a molecular weight of 287.30 g/mol. Its IUPAC name is 13-amino-4-methoxy-14-thia-8,11,12,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,12,15-hexaen-10-one.
| Compound Name | 13-amino-4-methoxy-14-thia-8,11,12,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,12,15-hexaen-10-one |
|---|---|
| PubChem CID | 5305197 |
| Molecular Formula | C12H9N5O2S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 13-amino-4-methoxy-14-thia-8,11,12,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,12,15-hexaen-10-one |
| SMILES | COc1ccc2[nH]c3c(=O)n4nc(N)sc4nc3c2c1 |
| InChI | InChI=1S/C12H9N5O2S/c1-19-5-2-3-7-6(4-5)8-9(14-7)10(18)17-12(15-8)20-11(13)16-17/h2-4,14H,1H3,(H2,13,16) |
| InChIKey | UKVJHWTWGLFIID-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |