C11H6N4OS — CID 3088108
14-thia-8,11,12,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,15-hexaen-10-one (PubChem CID 3088108) has the molecular formula C11H6N4OS and a molecular weight of 242.26 g/mol. Its IUPAC name is 14-thia-8,11,12,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,15-hexaen-10-one.
| Compound Name | 14-thia-8,11,12,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,15-hexaen-10-one |
|---|---|
| PubChem CID | 3088108 |
| Molecular Formula | C11H6N4OS |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 14-thia-8,11,12,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,15-hexaen-10-one |
| SMILES | O=c1c2[nH]c3ccccc3c2nc2scnn12 |
| InChI | InChI=1S/C11H6N4OS/c16-10-9-8(14-11-15(10)12-5-17-11)6-3-1-2-4-7(6)13-9/h1-5,13H |
| InChIKey | BEPWWKQOCLWXFC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |