C18H14N4O — CID 5408888
3-[(Z)-benzylideneamino]-2-methyl-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 5408888) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-[(Z)-benzylideneamino]-2-methyl-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-[(Z)-benzylideneamino]-2-methyl-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 5408888 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-[(Z)-benzylideneamino]-2-methyl-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | Cc1nc2c([nH]c3ccccc32)c(=O)n1/N=C\c1ccccc1 |
| InChI | InChI=1S/C18H14N4O/c1-12-20-16-14-9-5-6-10-15(14)21-17(16)18(23)22(12)19-11-13-7-3-2-4-8-13/h2-11,21H,1H3/b19-11- |
| InChIKey | DYSLWMWFWFYELH-ODLFYWEKSA-N |
| XLogP | 3.07 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|