C16H11N5O2 — CID 135764923
3-[(E)-(4-hydroxyphenyl)methylideneamino]-5H-triazino[5,4-b]indol-4-one (PubChem CID 135764923) has the molecular formula C16H11N5O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-[(E)-(4-hydroxyphenyl)methylideneamino]-5H-triazino[5,4-b]indol-4-one.
| Compound Name | 3-[(E)-(4-hydroxyphenyl)methylideneamino]-5H-triazino[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 135764923 |
| Molecular Formula | C16H11N5O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-[(E)-(4-hydroxyphenyl)methylideneamino]-5H-triazino[5,4-b]indol-4-one |
| SMILES | O=c1c2[nH]c3ccccc3c2nnn1/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C16H11N5O2/c22-11-7-5-10(6-8-11)9-17-21-16(23)15-14(19-20-21)12-3-1-2-4-13(12)18-15/h1-9,18,22H/b17-9+ |
| InChIKey | ANNIRGBPLHRRKP-RQZCQDPDSA-N |
| XLogP | 1.86 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|