C17H11BrN4O3 — CID 1419802
8-bromo-3-[(4-hydroxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 1419802) has the molecular formula C17H11BrN4O3 and a molecular weight of 399.20 g/mol. Its IUPAC name is 8-bromo-3-[(4-hydroxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 8-bromo-3-[(4-hydroxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 1419802 |
| Molecular Formula | C17H11BrN4O3 |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 8-bromo-3-[(4-hydroxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | O=c1[nH]c2c([nH]c3ccc(Br)cc32)c(=O)n1N=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C17H11BrN4O3/c18-10-3-6-13-12(7-10)14-15(20-13)16(24)22(17(25)21-14)19-8-9-1-4-11(23)5-2-9/h1-8,20,23H,(H,21,25) |
| InChIKey | CHSVNAVLZIRSQB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|