C18H13BrN4O4 — CID 135822221
3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-7-methoxy-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 135822221) has the molecular formula C18H13BrN4O4 and a molecular weight of 429.23 g/mol. Its IUPAC name is 3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-7-methoxy-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-7-methoxy-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 135822221 |
| Molecular Formula | C18H13BrN4O4 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-7-methoxy-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | COc1ccc2c(c1)[nH]c1c(=O)n(/N=C/c3cc(Br)ccc3O)c(=O)[nH]c12 |
| InChI | InChI=1S/C18H13BrN4O4/c1-27-11-3-4-12-13(7-11)21-16-15(12)22-18(26)23(17(16)25)20-8-9-6-10(19)2-5-14(9)24/h2-8,21,24H,1H3,(H,22,26)/b20-8+ |
| InChIKey | PDKREPWVCKGQHF-DNTJNYDQSA-N |
| XLogP | 2.53 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|