C26H30N4O4 — CID 6868216
7-methoxy-3-[(E)-(4-octoxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 6868216) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 7-methoxy-3-[(E)-(4-octoxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 7-methoxy-3-[(E)-(4-octoxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 6868216 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 7-methoxy-3-[(E)-(4-octoxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | CCCCCCCCOc1ccc(/C=N/n2c(=O)[nH]c3c([nH]c4cc(OC)ccc43)c2=O)cc1 |
| InChI | InChI=1S/C26H30N4O4/c1-3-4-5-6-7-8-15-34-19-11-9-18(10-12-19)17-27-30-25(31)24-23(29-26(30)32)21-14-13-20(33-2)16-22(21)28-24/h9-14,16-17,28H,3-8,15H2,1-2H3,(H,29,32)/b27-17+ |
| InChIKey | ZSJLLJFVPLJYKS-WPWMEQJKSA-N |
| XLogP | 4.80 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|