C19H15FN4O2 — CID 6890373
3-[(E)-(4-fluorophenyl)methylideneamino]-7-methoxy-2-methyl-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 6890373) has the molecular formula C19H15FN4O2 and a molecular weight of 350.35 g/mol. Its IUPAC name is 3-[(E)-(4-fluorophenyl)methylideneamino]-7-methoxy-2-methyl-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-[(E)-(4-fluorophenyl)methylideneamino]-7-methoxy-2-methyl-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 6890373 |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-[(E)-(4-fluorophenyl)methylideneamino]-7-methoxy-2-methyl-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | COc1ccc2c(c1)[nH]c1c(=O)n(/N=C/c3ccc(F)cc3)c(C)nc12 |
| InChI | InChI=1S/C19H15FN4O2/c1-11-22-17-15-8-7-14(26-2)9-16(15)23-18(17)19(25)24(11)21-10-12-3-5-13(20)6-4-12/h3-10,23H,1-2H3/b21-10+ |
| InChIKey | OCDCGSRWMZEBLW-UFFVCSGVSA-N |
| XLogP | 3.22 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|