C17H13N5O3 — CID 5423993
7-methoxy-3-[(Z)-pyridin-4-ylmethylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 5423993) has the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. Its IUPAC name is 7-methoxy-3-[(Z)-pyridin-4-ylmethylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 7-methoxy-3-[(Z)-pyridin-4-ylmethylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 5423993 |
| Molecular Formula | C17H13N5O3 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 7-methoxy-3-[(Z)-pyridin-4-ylmethylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | COc1ccc2c(c1)[nH]c1c(=O)n(/N=C\c3ccncc3)c(=O)[nH]c12 |
| InChI | InChI=1S/C17H13N5O3/c1-25-11-2-3-12-13(8-11)20-15-14(12)21-17(24)22(16(15)23)19-9-10-4-6-18-7-5-10/h2-9,20H,1H3,(H,21,24)/b19-9- |
| InChIKey | IWTONNVAMBLDNK-OCKHKDLRSA-N |
| XLogP | 1.46 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|