C21H24N4O3 — CID 92526057
7-methoxy-3-[(Z)-[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 92526057) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 7-methoxy-3-[(Z)-[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 7-methoxy-3-[(Z)-[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 92526057 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 7-methoxy-3-[(Z)-[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | COc1ccc2c(c1)[nH]c1c(=O)n(/N=C\[C@H]3[C@@H](C)C=C(C)C[C@@H]3C)c(=O)[nH]c12 |
| InChI | InChI=1S/C21H24N4O3/c1-11-7-12(2)16(13(3)8-11)10-22-25-20(26)19-18(24-21(25)27)15-6-5-14(28-4)9-17(15)23-19/h5-7,9-10,12-13,16,23H,8H2,1-4H3,(H,24,27)/b22-10+/t12-,13-,16-/m0/s1 |
| InChIKey | HSDNTQVKHHCNKZ-DOPUNYGQSA-N |
| XLogP | 3.25 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|