C25H30N4O3 — CID 25425285
8-methoxy-3-[(Z)-[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 25425285) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 8-methoxy-3-[(Z)-[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 8-methoxy-3-[(Z)-[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 25425285 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 8-methoxy-3-[(Z)-[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | COc1ccc2[nH]c3c(=O)n(/N=C\[C@H]4CC=C(CCC=C(C)C)C[C@H]4C)c(=O)[nH]c3c2c1 |
| InChI | InChI=1S/C25H30N4O3/c1-15(2)6-5-7-17-8-9-18(16(3)12-17)14-26-29-24(30)23-22(28-25(29)31)20-13-19(32-4)10-11-21(20)27-23/h6,8,10-11,13-14,16,18,27H,5,7,9,12H2,1-4H3,(H,28,31)/b26-14-/t16-,18-/m1/s1 |
| InChIKey | ZTMKRAFIEVYSGH-FMHQCXGHSA-N |
| XLogP | 4.73 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|