C16H11N5O — CID 6881688
3-[(E)-pyridin-3-ylmethylideneamino]-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 6881688) has the molecular formula C16H11N5O and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-[(E)-pyridin-3-ylmethylideneamino]-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-[(E)-pyridin-3-ylmethylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 6881688 |
| Molecular Formula | C16H11N5O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-[(E)-pyridin-3-ylmethylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | O=c1c2[nH]c3ccccc3c2ncn1/N=C/c1cccnc1 |
| InChI | InChI=1S/C16H11N5O/c22-16-15-14(12-5-1-2-6-13(12)20-15)18-10-21(16)19-9-11-4-3-7-17-8-11/h1-10,20H/b19-9+ |
| InChIKey | DIASVIBSKWVQJJ-DJKKODMXSA-N |
| XLogP | 2.15 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|