C18H13FN4O — CID 5418464
3-[(Z)-(2-fluorophenyl)methylideneamino]-8-methyl-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 5418464) has the molecular formula C18H13FN4O and a molecular weight of 320.33 g/mol. Its IUPAC name is 3-[(Z)-(2-fluorophenyl)methylideneamino]-8-methyl-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-[(Z)-(2-fluorophenyl)methylideneamino]-8-methyl-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 5418464 |
| Molecular Formula | C18H13FN4O |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 3-[(Z)-(2-fluorophenyl)methylideneamino]-8-methyl-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | Cc1ccc2[nH]c3c(=O)n(/N=C\c4ccccc4F)cnc3c2c1 |
| InChI | InChI=1S/C18H13FN4O/c1-11-6-7-15-13(8-11)16-17(22-15)18(24)23(10-20-16)21-9-12-4-2-3-5-14(12)19/h2-10,22H,1H3/b21-9- |
| InChIKey | CBAZNNGVWADXSW-NKVSQWTQSA-N |
| XLogP | 3.21 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|