C17H11ClN4O3 — CID 136764622
8-chloro-3-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 136764622) has the molecular formula C17H11ClN4O3 and a molecular weight of 354.75 g/mol. Its IUPAC name is 8-chloro-3-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 8-chloro-3-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 136764622 |
| Molecular Formula | C17H11ClN4O3 |
| Molecular Weight | 354.75 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 8-chloro-3-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | O=c1c2[nH]c3ccc(Cl)cc3c2ncn1/N=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C17H11ClN4O3/c18-10-2-4-13-12(5-10)15-16(21-13)17(25)22(8-19-15)20-7-9-1-3-11(23)6-14(9)24/h1-8,21,23-24H/b20-7- |
| InChIKey | RJLMTPPJACZKPG-SCDVKCJHSA-N |
| XLogP | 2.82 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|