C20H18N4O5 — CID 136815801
3-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-8-methoxy-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 136815801) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is 3-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-8-methoxy-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-8-methoxy-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 136815801 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 3-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-8-methoxy-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | COc1ccc2[nH]c3c(=O)n(/N=C\c4cc(OC)c(O)c(OC)c4)cnc3c2c1 |
| InChI | InChI=1S/C20H18N4O5/c1-27-12-4-5-14-13(8-12)17-18(23-14)20(26)24(10-21-17)22-9-11-6-15(28-2)19(25)16(7-11)29-3/h4-10,23,25H,1-3H3/b22-9- |
| InChIKey | WERSMFUXBCPYPJ-AFPJDJCSSA-N |
| XLogP | 2.49 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|