C17H13N5O2 — CID 914353
8-methoxy-3-(pyridin-3-ylmethylideneamino)-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 914353) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is 8-methoxy-3-(pyridin-3-ylmethylideneamino)-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 8-methoxy-3-(pyridin-3-ylmethylideneamino)-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 914353 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 8-methoxy-3-(pyridin-3-ylmethylideneamino)-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | COc1ccc2[nH]c3c(=O)n(N=Cc4cccnc4)cnc3c2c1 |
| InChI | InChI=1S/C17H13N5O2/c1-24-12-4-5-14-13(7-12)15-16(21-14)17(23)22(10-19-15)20-9-11-3-2-6-18-8-11/h2-10,21H,1H3 |
| InChIKey | YNLSVOAICMTDBL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|