C18H13N5O3 — CID 914970
2-methyl-3-[(3-nitrophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 914970) has the molecular formula C18H13N5O3 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-methyl-3-[(3-nitrophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 2-methyl-3-[(3-nitrophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 914970 |
| Molecular Formula | C18H13N5O3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-methyl-3-[(3-nitrophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | Cc1nc2c([nH]c3ccccc32)c(=O)n1N=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13N5O3/c1-11-20-16-14-7-2-3-8-15(14)21-17(16)18(24)22(11)19-10-12-5-4-6-13(9-12)23(25)26/h2-10,21H,1H3 |
| InChIKey | KFANLKWZOVHSQX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|