C17H11N3O3 — CID 136691479
3-oxo-2-phenyl-5H-pyridazino[4,3-b]indole-4-carboxylic acid (PubChem CID 136691479) has the molecular formula C17H11N3O3 and a molecular weight of 305.29 g/mol. Its IUPAC name is 3-oxo-2-phenyl-5H-pyridazino[4,3-b]indole-4-carboxylic acid.
| Compound Name | 3-oxo-2-phenyl-5H-pyridazino[4,3-b]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 136691479 |
| Molecular Formula | C17H11N3O3 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-oxo-2-phenyl-5H-pyridazino[4,3-b]indole-4-carboxylic acid |
| SMILES | O=C(O)c1c(=O)n(-c2ccccc2)nc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C17H11N3O3/c21-16-13(17(22)23)15-14(11-8-4-5-9-12(11)18-15)19-20(16)10-6-2-1-3-7-10/h1-9,18H,(H,22,23) |
| InChIKey | ZZVNRKHCNTUORU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |