C9H9ClN2O3 — CID 139789837
6-methoxy-1H-quinazoline-2,4-dione;hydrochloride (PubChem CID 139789837) has the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. Its IUPAC name is 6-methoxy-1H-quinazoline-2,4-dione;hydrochloride.
| Compound Name | 6-methoxy-1H-quinazoline-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 139789837 |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 6-methoxy-1H-quinazoline-2,4-dione;hydrochloride |
| SMILES | COc1ccc2[nH]c(=O)[nH]c(=O)c2c1.Cl |
| InChI | InChI=1S/C9H8N2O3.ClH/c1-14-5-2-3-7-6(4-5)8(12)11-9(13)10-7;/h2-4H,1H3,(H2,10,11,12,13);1H |
| InChIKey | TUJHXTWLIWCAAE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |