C10H11ClN2O4 — CID 139789848
6,7-dimethoxy-1H-quinazoline-2,4-dione;hydrochloride (PubChem CID 139789848) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is 6,7-dimethoxy-1H-quinazoline-2,4-dione;hydrochloride.
| Compound Name | 6,7-dimethoxy-1H-quinazoline-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 139789848 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 6,7-dimethoxy-1H-quinazoline-2,4-dione;hydrochloride |
| SMILES | COc1cc2[nH]c(=O)[nH]c(=O)c2cc1OC.Cl |
| InChI | InChI=1S/C10H10N2O4.ClH/c1-15-7-3-5-6(4-8(7)16-2)11-10(14)12-9(5)13;/h3-4H,1-2H3,(H2,11,12,13,14);1H |
| InChIKey | VEPYXFRELZSXDF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |