C15H13NO3 — CID 12703535
8,9-dimethoxy-5H-phenanthridin-6-one (PubChem CID 12703535) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 8,9-dimethoxy-5H-phenanthridin-6-one.
| Compound Name | 8,9-dimethoxy-5H-phenanthridin-6-one |
|---|---|
| PubChem CID | 12703535 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 8,9-dimethoxy-5H-phenanthridin-6-one |
| SMILES | COc1cc2c(=O)[nH]c3ccccc3c2cc1OC |
| InChI | InChI=1S/C15H13NO3/c1-18-13-7-10-9-5-3-4-6-12(9)16-15(17)11(10)8-14(13)19-2/h3-8H,1-2H3,(H,16,17) |
| InChIKey | JSZDJKBYMGGQAL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|