C12H13N3O4 — CID 110169121
4-amino-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonitrile;hydrate (PubChem CID 110169121) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 4-amino-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonitrile;hydrate.
| Compound Name | 4-amino-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonitrile;hydrate |
|---|---|
| PubChem CID | 110169121 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-amino-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonitrile;hydrate |
| SMILES | COc1cc2[nH]c(=O)c(C#N)c(N)c2cc1OC.O |
| InChI | InChI=1S/C12H11N3O3.H2O/c1-17-9-3-6-8(4-10(9)18-2)15-12(16)7(5-13)11(6)14;/h3-4H,1-2H3,(H3,14,15,16);1H2 |
| InChIKey | DALJHCDDLCEXSH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |