C11H7ClN2O3 — CID 134987165
6-chloro-4-hydroxy-7-methoxy-2-oxo-1H-quinoline-3-carbonitrile (PubChem CID 134987165) has the molecular formula C11H7ClN2O3 and a molecular weight of 250.64 g/mol. Its IUPAC name is 6-chloro-4-hydroxy-7-methoxy-2-oxo-1H-quinoline-3-carbonitrile.
| Compound Name | 6-chloro-4-hydroxy-7-methoxy-2-oxo-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 134987165 |
| Molecular Formula | C11H7ClN2O3 |
| Molecular Weight | 250.64 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 6-chloro-4-hydroxy-7-methoxy-2-oxo-1H-quinoline-3-carbonitrile |
| SMILES | COc1cc2[nH]c(=O)c(C#N)c(O)c2cc1Cl |
| InChI | InChI=1S/C11H7ClN2O3/c1-17-9-3-8-5(2-7(9)12)10(15)6(4-13)11(16)14-8/h2-3H,1H3,(H2,14,15,16) |
| InChIKey | CRUZYCHPNVWCAA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |