C15H18N2O2 — CID 143489828
butane;4-hydroxy-6-methyl-2-oxo-1H-quinoline-3-carbonitrile (PubChem CID 143489828) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is butane;4-hydroxy-6-methyl-2-oxo-1H-quinoline-3-carbonitrile.
| Compound Name | butane;4-hydroxy-6-methyl-2-oxo-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 143489828 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | butane;4-hydroxy-6-methyl-2-oxo-1H-quinoline-3-carbonitrile |
| SMILES | CCCC.Cc1ccc2[nH]c(=O)c(C#N)c(O)c2c1 |
| InChI | InChI=1S/C11H8N2O2.C4H10/c1-6-2-3-9-7(4-6)10(14)8(5-12)11(15)13-9;1-3-4-2/h2-4H,1H3,(H2,13,14,15);3-4H2,1-2H3 |
| InChIKey | MYROSFOQRMXGFK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |