C15H11NO3S — CID 139646774
4-hydroxy-6-methyl-3-(thiophene-2-carbonyl)-1H-quinolin-2-one (PubChem CID 139646774) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-(thiophene-2-carbonyl)-1H-quinolin-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-(thiophene-2-carbonyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 139646774 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 4-hydroxy-6-methyl-3-(thiophene-2-carbonyl)-1H-quinolin-2-one |
| SMILES | Cc1ccc2[nH]c(=O)c(C(=O)c3cccs3)c(O)c2c1 |
| InChI | InChI=1S/C15H11NO3S/c1-8-4-5-10-9(7-8)13(17)12(15(19)16-10)14(18)11-3-2-6-20-11/h2-7H,1H3,(H2,16,17,19) |
| InChIKey | UIMIIUQOQJYQKV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |