C20H22N2OS — CID 84580370
[4-(3,5-dimethyl-1H-indol-2-yl)piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 84580370) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is [4-(3,5-dimethyl-1H-indol-2-yl)piperidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(3,5-dimethyl-1H-indol-2-yl)piperidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 84580370 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [4-(3,5-dimethyl-1H-indol-2-yl)piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | Cc1ccc2[nH]c(C3CCN(C(=O)c4cccs4)CC3)c(C)c2c1 |
| InChI | InChI=1S/C20H22N2OS/c1-13-5-6-17-16(12-13)14(2)19(21-17)15-7-9-22(10-8-15)20(23)18-4-3-11-24-18/h3-6,11-12,15,21H,7-10H2,1-2H3 |
| InChIKey | AUEKBGANLKTSHY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |