C23H22N4OS2 — CID 15951336
N'-[3-[1-(thiophene-2-carbonyl)piperidin-4-yl]-1H-indol-5-yl]thiophene-2-carboximidamide (PubChem CID 15951336) has the molecular formula C23H22N4OS2 and a molecular weight of 434.59 g/mol. Its IUPAC name is N'-[3-[1-(thiophene-2-carbonyl)piperidin-4-yl]-1H-indol-5-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-[1-(thiophene-2-carbonyl)piperidin-4-yl]-1H-indol-5-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 15951336 |
| Molecular Formula | C23H22N4OS2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N'-[3-[1-(thiophene-2-carbonyl)piperidin-4-yl]-1H-indol-5-yl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc2[nH]cc(C3CCN(C(=O)c4cccs4)CC3)c2c1)c1cccs1 |
| InChI | InChI=1S/C23H22N4OS2/c24-22(20-3-1-11-29-20)26-16-5-6-19-17(13-16)18(14-25-19)15-7-9-27(10-8-15)23(28)21-4-2-12-30-21/h1-6,11-15,25H,7-10H2,(H2,24,26) |
| InChIKey | KBQDIKBMHNQJSA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|