C17H16N2OS — CID 110711020
[3-(1H-indol-3-yl)pyrrolidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 110711020) has the molecular formula C17H16N2OS and a molecular weight of 296.39 g/mol. Its IUPAC name is [3-(1H-indol-3-yl)pyrrolidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [3-(1H-indol-3-yl)pyrrolidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 110711020 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | [3-(1H-indol-3-yl)pyrrolidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC(c2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C17H16N2OS/c20-17(16-6-3-9-21-16)19-8-7-12(11-19)14-10-18-15-5-2-1-4-13(14)15/h1-6,9-10,12,18H,7-8,11H2 |
| InChIKey | YJSKHEKBFFBRGA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |