C26H24N2O — CID 113087750
1-[3-(1H-indol-3-yl)pyrrolidin-1-yl]-2,2-diphenylethanone (PubChem CID 113087750) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)pyrrolidin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[3-(1H-indol-3-yl)pyrrolidin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 113087750 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)pyrrolidin-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCC(c2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C26H24N2O/c29-26(25(19-9-3-1-4-10-19)20-11-5-2-6-12-20)28-16-15-21(18-28)23-17-27-24-14-8-7-13-22(23)24/h1-14,17,21,25,27H,15-16,18H2 |
| InChIKey | TWMXEPAHZGRESB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |