C63H78N12S3 — CID 159028072
N'-[3-[4-(ethylamino)cyclohexyl]-1H-indol-5-yl]thiophene-2-carboximidamide (PubChem CID 159028072) has the molecular formula C63H78N12S3 and a molecular weight of 1099.60 g/mol. Its IUPAC name is N'-[3-[4-(ethylamino)cyclohexyl]-1H-indol-5-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-[4-(ethylamino)cyclohexyl]-1H-indol-5-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 159028072 |
| Molecular Formula | C63H78N12S3 |
| Molecular Weight | 1099.60 g/mol |
| Exact Mass | 1098.56 |
| IUPAC Name | N'-[3-[4-(ethylamino)cyclohexyl]-1H-indol-5-yl]thiophene-2-carboximidamide |
| SMILES | CCNC1CCC(c2c[nH]c3ccc(/N=C(\N)c4cccs4)cc23)CC1.CCNC1CCC(c2c[nH]c3ccc(/N=C(\N)c4cccs4)cc23)CC1.CCNC1CCC(c2c[nH]c3ccc(/N=C(\N)c4cccs4)cc23)CC1 |
| InChI | InChI=1S/3C21H26N4S/c3*1-2-23-15-7-5-14(6-8-15)18-13-24-19-10-9-16(12-17(18)19)25-21(22)20-4-3-11-26-20/h3*3-4,9-15,23-24H,2,5-8H2,1H3,(H2,22,25) |
| InChIKey | JUNKVWYQSAMCRV-UHFFFAOYSA-N |
| XLogP | 14.71 |
| TPSA | 198.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.60 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|