C17H19ClN2S — CID 70141265
N'-[3-(chloromethyl)-4-cyclopentylphenyl]thiophene-2-carboximidamide (PubChem CID 70141265) has the molecular formula C17H19ClN2S and a molecular weight of 318.87 g/mol. Its IUPAC name is N'-[3-(chloromethyl)-4-cyclopentylphenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-(chloromethyl)-4-cyclopentylphenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 70141265 |
| Molecular Formula | C17H19ClN2S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N'-[3-(chloromethyl)-4-cyclopentylphenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(C2CCCC2)c(CCl)c1)c1cccs1 |
| InChI | InChI=1S/C17H19ClN2S/c18-11-13-10-14(20-17(19)16-6-3-9-21-16)7-8-15(13)12-4-1-2-5-12/h3,6-10,12H,1-2,4-5,11H2,(H2,19,20) |
| InChIKey | UTSKLYVSBLGHLU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|