C15H18Cl2N2OS — CID 70131323
N'-[3-(chloromethyl)-4-propan-2-yloxyphenyl]thiophene-2-carboximidamide;hydrochloride (PubChem CID 70131323) has the molecular formula C15H18Cl2N2OS and a molecular weight of 345.30 g/mol. Its IUPAC name is N'-[3-(chloromethyl)-4-propan-2-yloxyphenyl]thiophene-2-carboximidamide;hydrochloride.
| Compound Name | N'-[3-(chloromethyl)-4-propan-2-yloxyphenyl]thiophene-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 70131323 |
| Molecular Formula | C15H18Cl2N2OS |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N'-[3-(chloromethyl)-4-propan-2-yloxyphenyl]thiophene-2-carboximidamide;hydrochloride |
| SMILES | CC(C)Oc1ccc(/N=C(\N)c2cccs2)cc1CCl.Cl |
| InChI | InChI=1S/C15H17ClN2OS.ClH/c1-10(2)19-13-6-5-12(8-11(13)9-16)18-15(17)14-4-3-7-20-14;/h3-8,10H,9H2,1-2H3,(H2,17,18);1H |
| InChIKey | NGDQAHNRHAWOTO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|