C19H19N3OS — CID 10131918
N'-[3-(methylaminomethyl)-4-phenoxyphenyl]thiophene-2-carboximidamide (PubChem CID 10131918) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is N'-[3-(methylaminomethyl)-4-phenoxyphenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-(methylaminomethyl)-4-phenoxyphenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 10131918 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N'-[3-(methylaminomethyl)-4-phenoxyphenyl]thiophene-2-carboximidamide |
| SMILES | CNCc1cc(/N=C(\N)c2cccs2)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C19H19N3OS/c1-21-13-14-12-15(22-19(20)18-8-5-11-24-18)9-10-17(14)23-16-6-3-2-4-7-16/h2-12,21H,13H2,1H3,(H2,20,22) |
| InChIKey | FHQHEWCYRJTXIV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|