C27H25N3O2S — CID 22646356
4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-N-(4-phenoxyphenyl)butanamide (PubChem CID 22646356) has the molecular formula C27H25N3O2S and a molecular weight of 455.58 g/mol. Its IUPAC name is 4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-N-(4-phenoxyphenyl)butanamide.
| Compound Name | 4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-N-(4-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 22646356 |
| Molecular Formula | C27H25N3O2S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-N-(4-phenoxyphenyl)butanamide |
| SMILES | N/C(=N\c1ccc(CCCC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1)c1cccs1 |
| InChI | InChI=1S/C27H25N3O2S/c28-27(25-9-5-19-33-25)30-22-13-11-20(12-14-22)6-4-10-26(31)29-21-15-17-24(18-16-21)32-23-7-2-1-3-8-23/h1-3,5,7-9,11-19H,4,6,10H2,(H2,28,30)(H,29,31) |
| InChIKey | QNWNJSHYOXWUGV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|