C18H15N3OS — CID 19353808
4-[[amino(thiophen-2-yl)methylidene]amino]-N-phenylbenzamide (PubChem CID 19353808) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is 4-[[amino(thiophen-2-yl)methylidene]amino]-N-phenylbenzamide.
| Compound Name | 4-[[amino(thiophen-2-yl)methylidene]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 19353808 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 4-[[amino(thiophen-2-yl)methylidene]amino]-N-phenylbenzamide |
| SMILES | N/C(=N\c1ccc(C(=O)Nc2ccccc2)cc1)c1cccs1 |
| InChI | InChI=1S/C18H15N3OS/c19-17(16-7-4-12-23-16)20-15-10-8-13(9-11-15)18(22)21-14-5-2-1-3-6-14/h1-12H,(H2,19,20)(H,21,22) |
| InChIKey | SKIJHWYDVBYQTG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|