C24H20N4OS — CID 19353824
3-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-1,1-diphenylurea (PubChem CID 19353824) has the molecular formula C24H20N4OS and a molecular weight of 412.52 g/mol. Its IUPAC name is 3-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-1,1-diphenylurea.
| Compound Name | 3-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-1,1-diphenylurea |
|---|---|
| PubChem CID | 19353824 |
| Molecular Formula | C24H20N4OS |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 3-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-1,1-diphenylurea |
| SMILES | N/C(=N\c1ccc(NC(=O)N(c2ccccc2)c2ccccc2)cc1)c1cccs1 |
| InChI | InChI=1S/C24H20N4OS/c25-23(22-12-7-17-30-22)26-18-13-15-19(16-14-18)27-24(29)28(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-17H,(H2,25,26)(H,27,29) |
| InChIKey | KTTIWZOCJGOHQF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|