C29H32N6OS — CID 70185764
acetamide;N'-[4-[4-(4-anilinophenyl)piperazin-1-yl]phenyl]thiophene-2-carboximidamide (PubChem CID 70185764) has the molecular formula C29H32N6OS and a molecular weight of 512.68 g/mol. Its IUPAC name is acetamide;N'-[4-[4-(4-anilinophenyl)piperazin-1-yl]phenyl]thiophene-2-carboximidamide.
| Compound Name | acetamide;N'-[4-[4-(4-anilinophenyl)piperazin-1-yl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 70185764 |
| Molecular Formula | C29H32N6OS |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | acetamide;N'-[4-[4-(4-anilinophenyl)piperazin-1-yl]phenyl]thiophene-2-carboximidamide |
| SMILES | CC(N)=O.N/C(=N\c1ccc(N2CCN(c3ccc(Nc4ccccc4)cc3)CC2)cc1)c1cccs1 |
| InChI | InChI=1S/C27H27N5S.C2H5NO/c28-27(26-7-4-20-33-26)30-23-10-14-25(15-11-23)32-18-16-31(17-19-32)24-12-8-22(9-13-24)29-21-5-2-1-3-6-21;1-2(3)4/h1-15,20,29H,16-19H2,(H2,28,30);1H3,(H2,3,4) |
| InChIKey | BKGMDUFTSWNVHP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|