C27H28N4S — CID 22646381
N'-[4-[4-(4-anilinoanilino)butyl]phenyl]thiophene-2-carboximidamide (PubChem CID 22646381) has the molecular formula C27H28N4S and a molecular weight of 440.62 g/mol. Its IUPAC name is N'-[4-[4-(4-anilinoanilino)butyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[4-(4-anilinoanilino)butyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 22646381 |
| Molecular Formula | C27H28N4S |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N'-[4-[4-(4-anilinoanilino)butyl]phenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(CCCCNc2ccc(Nc3ccccc3)cc2)cc1)c1cccs1 |
| InChI | InChI=1S/C27H28N4S/c28-27(26-10-6-20-32-26)31-25-13-11-21(12-14-25)7-4-5-19-29-22-15-17-24(18-16-22)30-23-8-2-1-3-9-23/h1-3,6,8-18,20,29-30H,4-5,7,19H2,(H2,28,31) |
| InChIKey | VJKTYRYGNWPFIM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|