C27H26N4OS — CID 15462191
4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-N-(2-anilinophenyl)butanamide (PubChem CID 15462191) has the molecular formula C27H26N4OS and a molecular weight of 454.60 g/mol. Its IUPAC name is 4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-N-(2-anilinophenyl)butanamide.
| Compound Name | 4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-N-(2-anilinophenyl)butanamide |
|---|---|
| PubChem CID | 15462191 |
| Molecular Formula | C27H26N4OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-N-(2-anilinophenyl)butanamide |
| SMILES | N/C(=N\c1ccc(CCCC(=O)Nc2ccccc2Nc2ccccc2)cc1)c1cccs1 |
| InChI | InChI=1S/C27H26N4OS/c28-27(25-13-7-19-33-25)30-22-17-15-20(16-18-22)8-6-14-26(32)31-24-12-5-4-11-23(24)29-21-9-2-1-3-10-21/h1-5,7,9-13,15-19,29H,6,8,14H2,(H2,28,30)(H,31,32) |
| InChIKey | LVWIFLFDIBOVBM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|