C20H20ClN3OS — CID 142649841
2-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]benzamide;hydrochloride (PubChem CID 142649841) has the molecular formula C20H20ClN3OS and a molecular weight of 385.92 g/mol. Its IUPAC name is 2-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]benzamide;hydrochloride.
| Compound Name | 2-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 142649841 |
| Molecular Formula | C20H20ClN3OS |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccccc1CCc1ccc(/N=C(\N)c2cccs2)cc1 |
| InChI | InChI=1S/C20H19N3OS.ClH/c21-19(18-6-3-13-25-18)23-16-11-8-14(9-12-16)7-10-15-4-1-2-5-17(15)20(22)24;/h1-6,8-9,11-13H,7,10H2,(H2,21,23)(H2,22,24);1H |
| InChIKey | WEGCCHWKDMDMGM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|