C15H12N4OS2 — CID 154489738
2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 154489738) has the molecular formula C15H12N4OS2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 154489738 |
| Molecular Formula | C15H12N4OS2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(-c2ccc(/N=C(\N)c3cccs3)cc2)n1 |
| InChI | InChI=1S/C15H12N4OS2/c16-13(12-2-1-7-21-12)18-10-5-3-9(4-6-10)15-19-11(8-22-15)14(17)20/h1-8H,(H2,16,18)(H2,17,20) |
| InChIKey | OPEBDFRSRKTJAE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|