C10H7BrN2OS — CID 116892022
2-(2-bromophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 116892022) has the molecular formula C10H7BrN2OS and a molecular weight of 283.15 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-bromophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 116892022 |
| Molecular Formula | C10H7BrN2OS |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 2-(2-bromophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(-c2ccccc2Br)n1 |
| InChI | InChI=1S/C10H7BrN2OS/c11-7-4-2-1-3-6(7)10-13-8(5-15-10)9(12)14/h1-5H,(H2,12,14) |
| InChIKey | IHIOOUQCAICKSM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |